/* ════════════════════════════════════════════════════════════════
   Asteria — design system built (invisibly) on the golden ratio φ
   · Type scale:   ×√φ per step (two steps = ×φ), base 16px
   · Spacing:      Fibonacci — 5 8 13 21 34 55 89 144 233
   · Columns:      1.618fr : 1fr
   · Timing:       0.618s / 1.618s / 2.618s
   Night background; whatever you touch lights up in white.
   ════════════════════════════════════════════════════════════════ */
:root {
  --phi: 1.618;

  --f--1: 12.6px;
  --f-0: 16px;
  --f-1: 20.4px;
  --f-2: 25.9px;
  --f-3: 33px;
  --f-4: 41.9px;
  --f-5: 53.3px;
  --f-6: 67.8px;
  --f-7: 86.3px;

  --s-1: 5px;
  --s-2: 8px;
  --s-3: 13px;
  --s-4: 21px;
  --s-5: 34px;
  --s-6: 55px;
  --s-7: 89px;
  --s-8: 144px;

  --r-1: 8px;
  --r-2: 13px;
  --r-3: 21px;
  --r-4: 34px;

  --bg: #050505;
  --bg-2: #0a0a0b;
  --card: #0e0e10;
  --white: #ffffff;
  --text: #f4f4f5;
  --muted: #a1a1aa;
  --dim: #63636b;
  --line: rgba(255, 255, 255, 0.09);
  --line-2: rgba(255, 255, 255, 0.16);
  --glow: 0 0 0 1px rgba(255,255,255,.9), 0 0 34px rgba(255,255,255,.35), 0 0 89px rgba(255,255,255,.18);

  --serif: "Instrument Serif", Georgia, serif;
  --sans: "Geist", -apple-system, "Segoe UI", "PingFang SC", "Noto Sans SC", "Microsoft YaHei", Arial, sans-serif;
  --mono: "Geist Mono", ui-monospace, "SF Mono", Menlo, monospace;

  --ease: cubic-bezier(0.382, 0, 0, 1);
  --ease-out: cubic-bezier(0.16, 1, 0.3, 1);
  --t: 0.618s;
  --t-long: 1.618s;
}

*, *::before, *::after { box-sizing: border-box; }
html { scroll-behavior: smooth; -webkit-text-size-adjust: 100%; background: var(--bg); }
body { margin: 0; background: var(--bg); color: var(--text); font: 400 var(--f-0)/var(--phi) var(--sans); overflow-x: hidden; -webkit-font-smoothing: antialiased; text-rendering: optimizeLegibility; }
img { display: block; max-width: 100%; }
a { color: inherit; text-decoration: none; }
button, input, select, textarea { font: inherit; color: inherit; }
svg { fill: none; stroke: currentColor; stroke-width: 1.8; stroke-linecap: round; stroke-linejoin: round; }
ol, ul { margin: 0; padding: 0; list-style: none; }
::selection { background: #fff; color: #000; }
.mono { font-family: var(--mono); font-size: var(--f--1); letter-spacing: 0.02em; }
.container { width: 100%; max-width: 1220px; margin: 0 auto; padding: 0 var(--s-5); }
section { position: relative; }

main, .header, .footer { position: relative; z-index: 2; }

/* ── Scroll progress ── */
.progress { position: fixed; inset: 0 0 auto; height: 2px; z-index: 100; background: #fff; box-shadow: 0 0 13px #fff; transform-origin: 0 50%; transform: scaleX(var(--progress, 0)); pointer-events: none; }

/* ── Logo ── */
.ast { display: block; flex: none; width: 22px; height: 31px; overflow: visible; }
.logo { display: inline-flex; align-items: center; gap: var(--s-3); color: #fff; }
.logo .ast { width: 22px; height: 31px; transition: transform var(--t-long) var(--ease), filter var(--t) var(--ease); }
.logo:hover .ast { transform: rotate(60deg); filter: drop-shadow(0 0 8px #fff); }
.logo__word { font-size: var(--f-2); font-weight: 500; letter-spacing: -0.04em; line-height: 1; }
.logo__dot { color: var(--dim); }

/* ── Buttons: dark until touched, then they light up ── */
.btn { position: relative; display: inline-flex; align-items: center; justify-content: center; gap: var(--s-3); height: var(--s-6); padding: 0 var(--s-5); border-radius: 999px; font-weight: 500; font-size: var(--f-0); line-height: 1; border: 0; overflow: hidden; white-space: nowrap; transition: background var(--t) var(--ease), color var(--t) var(--ease), box-shadow var(--t) var(--ease); }
.btn > span { display: inline-block; text-shadow: 0 2.8em 0 currentColor; transition: transform var(--t) var(--ease); }
.btn:hover > span { transform: translateY(-2.8em); }
.btn svg { width: 18px; height: 18px; transition: transform var(--t) var(--ease); }
.btn:hover svg { transform: translate(3px, -3px); }
.btn--glow { background: rgba(255,255,255,.04); color: #fff; box-shadow: inset 0 0 0 1px var(--line-2); }
.btn--glow:hover { background: #fff; color: #000; box-shadow: var(--glow); }
.btn--solid { background: #fff; color: #000; box-shadow: 0 0 34px rgba(255,255,255,.18); }
.btn--solid:hover { box-shadow: var(--glow); }
.btn--block { width: 100%; }
.magnetic { will-change: transform; transition: transform var(--t) var(--ease-out), background var(--t) var(--ease), color var(--t) var(--ease), box-shadow var(--t) var(--ease); }

/* ── Header ── */
.header { position: fixed; inset: 0 0 auto; z-index: 50; transition: background var(--t) var(--ease), border-color var(--t) var(--ease), transform var(--t) var(--ease); border-bottom: 1px solid transparent; }
.header.is-scrolled { background: rgba(5,5,5,.72); backdrop-filter: blur(21px) saturate(1.4); -webkit-backdrop-filter: blur(21px) saturate(1.4); border-color: var(--line); }
.header.is-hidden { transform: translateY(-100%); }
.header__inner { max-width: 1220px; height: var(--s-7); margin: 0 auto; padding: 0 var(--s-5); display: flex; align-items: center; justify-content: space-between; position: relative; }
.nav { position: absolute; left: 50%; transform: translateX(-50%); display: flex; gap: var(--s-5); }
.nav a { position: relative; color: var(--muted); padding: var(--s-2) 0; transition: color var(--t) var(--ease), text-shadow var(--t) var(--ease); }
.nav a:hover { color: #fff; text-shadow: 0 0 13px rgba(255,255,255,.8); }
.header__end { display: flex; align-items: center; gap: var(--s-3); }
.header__cta { height: 44px; padding: 0 var(--s-4); }
.burger { display: none; background: none; border: 0; width: 44px; height: 44px; padding: 13px 10px; }
.burger span { display: block; height: 1.5px; background: #fff; margin: 6px 0; transition: transform var(--t) var(--ease); }
.burger[aria-expanded="true"] span:first-child { transform: translateY(3.75px) rotate(45deg); }
.burger[aria-expanded="true"] span:last-child { transform: translateY(-3.75px) rotate(-45deg); }
.mobile-nav { display: none; }

/* language switcher */
.lang { position: relative; }
.lang__btn { display: inline-flex; align-items: center; gap: 6px; height: 44px; padding: 0 var(--s-3); border-radius: 999px; background: transparent; border: 1px solid var(--line); color: var(--muted); font-family: var(--mono); font-size: var(--f--1); letter-spacing: .06em; transition: color var(--t) var(--ease), border-color var(--t) var(--ease); }
.lang__btn:hover, .lang__btn[aria-expanded="true"] { color: #fff; border-color: var(--line-2); }
.lang__btn svg { width: 13px; height: 13px; }
.lang__menu { position: absolute; right: 0; top: calc(100% + var(--s-2)); min-width: 160px; padding: var(--s-2); border-radius: var(--r-2); background: rgba(14,14,16,.96); backdrop-filter: blur(21px); border: 1px solid var(--line); box-shadow: 0 34px 55px -21px rgba(0,0,0,.8); animation: drop .38s var(--ease-out); }
.lang__menu[hidden] { display: none; }
@keyframes drop { from { opacity: 0; transform: translateY(-8px); } }
.lang__menu button { display: flex; width: 100%; justify-content: space-between; gap: var(--s-4); padding: var(--s-2) var(--s-3); border-radius: var(--r-1); background: none; border: 0; color: var(--muted); text-align: left; transition: background var(--t) var(--ease), color var(--t) var(--ease); }
.lang__menu button:hover, .lang__menu button[aria-selected="true"] { background: #fff; color: #000; }
.lang__menu .mono { opacity: .6; }

/* ── Section scaffolding ── */
.head { max-width: 760px; margin-bottom: var(--s-7); }
.head--split { max-width: none; display: grid; grid-template-columns: 1.618fr 1fr; gap: var(--s-6); align-items: end; }
.head--split .lead { margin-bottom: var(--s-4); }
.title { font-weight: 500; font-size: clamp(var(--f-4), 5.4vw, var(--f-6)); line-height: 1; letter-spacing: -0.045em; margin: 0 0 var(--s-4); color: #fff; }
.title em, .hero__title em { font-family: var(--serif); font-weight: 400; font-style: italic; letter-spacing: -0.02em; color: var(--muted); font-size: 1.08em; }
.lead { max-width: 34em; color: var(--muted); font-size: var(--f-1); line-height: 1.5; margin: 0; }
:lang(zh) .title em, :lang(zh) .hero__title em { font-family: var(--sans); font-style: normal; font-size: 1em; }

/* split-word titles */
[data-split] .w { display: inline-block; overflow: hidden; vertical-align: top; padding: 0 0.08em 0.12em 0; margin: 0 -0.08em -0.12em 0; }
[data-split] .w > span { display: inline-block; transform: translateY(105%); transition: transform 1s var(--ease-out); transition-delay: calc(var(--wi) * 55ms); }
[data-split].is-in .w > span { transform: none; }

.reveal { opacity: 0; transform: translateY(var(--s-5)); transition: opacity 1s var(--ease-out), transform 1s var(--ease-out); }
.reveal.is-in { opacity: 1; transform: none; }
.rise { animation: rise 1.2s var(--ease-out) both; animation-delay: var(--d, 0s); }
@keyframes rise { from { opacity: 0; transform: translateY(var(--s-5)); } }

/* ── Hero ── */
.hero { min-height: 100vh; min-height: 100svh; padding: var(--s-7) 0 0; overflow: hidden; display: flex; flex-direction: column; justify-content: space-between; }
.hero__grid { flex: 1; }
.hero .marquee { margin-top: var(--s-6); }
.hero::before { content: ""; position: absolute; inset: 0; background: radial-gradient(ellipse 61.8% 61.8% at 76.4% 38.2%, rgba(255,255,255,.06), transparent 61.8%); pointer-events: none; }
.hero__grid { position: relative; display: grid; grid-template-columns: 1.618fr 1fr; gap: var(--s-7); align-items: center; padding-top: var(--s-6); }

.badge { display: inline-flex; align-items: center; gap: var(--s-3); margin: 0 0 var(--s-5); height: 42px; padding: 0 var(--s-4) 0 var(--s-3); border-radius: 999px; background: linear-gradient(180deg, rgba(255,255,255,.07), rgba(255,255,255,.02)); border: 1px solid var(--line-2); box-shadow: inset 0 1px 0 rgba(255,255,255,.08); color: var(--muted); font-size: 14px; backdrop-filter: blur(13px); transition: box-shadow var(--t) var(--ease), color var(--t) var(--ease); }
.badge:hover { color: #fff; box-shadow: inset 0 1px 0 rgba(255,255,255,.08), 0 0 34px rgba(255,255,255,.12); }
.badge__dot { width: 8px; height: 8px; border-radius: 50%; background: #22c55e; box-shadow: 0 0 0 0 rgba(34,197,94,.6); animation: ping 2.618s var(--ease) infinite; }
@keyframes ping { 61.8% { box-shadow: 0 0 0 8px rgba(34,197,94,0); } 100% { box-shadow: 0 0 0 0 rgba(34,197,94,0); } }
.badge .g { width: 20px; height: 20px; }
.badge .stars { color: #fbbf24; letter-spacing: 2px; font-size: 15px; }
.badge b { color: #fff; font-weight: 600; }

.hero__title { font-weight: 500; font-size: clamp(var(--f-4), 5.4vw, var(--f-6)); line-height: 1.02; letter-spacing: -0.05em; color: #fff; margin: 0 0 var(--s-5); }
.hero__lead { max-width: 30em; margin: 0 0 var(--s-6); color: var(--muted); font-size: var(--f-1); line-height: 1.5; }
.hero__actions { display: flex; flex-wrap: wrap; gap: var(--s-3); }

/* rotating word, one every φ² s */
.rotator { position: relative; display: inline-grid; justify-items: start; vertical-align: top; overflow: hidden; padding: 0 0.08em 0.14em 0; margin: 0 -0.08em -0.14em 0; }
.rotator em { grid-area: 1 / 1; white-space: nowrap; color: #fff !important; transform: translateY(110%); transition: transform 0.9s var(--ease-out); }
.rotator em:first-child, .rotator em.is-on { transform: none; }
.rotator.js em:not(.is-on) { transform: translateY(110%); }
.rotator.js em.is-off { transform: translateY(-110%); }
.rotator.js em:not(.is-on):not(.is-off) { transition: none; }

.sr-only { position: absolute; width: 1px; height: 1px; overflow: hidden; clip: rect(0 0 0 0); white-space: nowrap; }

/* promises ticker */
.ticker { display: flex; align-items: center; gap: var(--s-3); margin: var(--s-5) 0 0; height: 21px; font-family: var(--mono); font-size: var(--f--1); letter-spacing: .04em; color: var(--muted); }
.ticker__dot { width: 5px; height: 5px; border-radius: 50%; background: #fff; box-shadow: 0 0 8px #fff; flex: none; }
.ticker__track { position: relative; display: inline-grid; overflow: hidden; height: 21px; }
.ticker__track > span { grid-area: 1 / 1; line-height: 21px; white-space: nowrap; transform: translateY(100%); opacity: 0; transition: transform .8s var(--ease-out), opacity .8s var(--ease-out); }
.ticker__track > span.is-on { transform: none; opacity: 1; }
.ticker__track > span.is-off { transform: translateY(-100%); opacity: 0; }
.ticker__track > span:not(.is-on):not(.is-off) { transition: none; }

/* the star draws itself, glows, and turns as you scroll */
.hero__star { position: relative; justify-self: center; width: min(100%, 377px); aspect-ratio: 1320 / 1870; }
.hero__halo { position: absolute; inset: -38.2%; border-radius: 50%; background: radial-gradient(circle, rgba(255,255,255,.16), rgba(255,255,255,.04) 38.2%, transparent 61.8%); animation: breathe 5.236s ease-in-out infinite; }
@keyframes breathe { 50% { opacity: .55; transform: scale(.94); } }
.hero__ast { position: relative; width: 100%; height: 100%; color: #fff; filter: drop-shadow(0 0 21px rgba(255,255,255,.45)); transform: rotate(calc(var(--sy, 0) * 0.09deg)); }
.hero__ast path { stroke-dasharray: 1; stroke-dashoffset: 1; animation: draw 1.3s var(--ease) forwards; animation-delay: calc(0.5s + var(--i) * 0.13s); }
@keyframes draw { to { stroke-dashoffset: 0; } }

/* ── Marquee ── */
.marquee { overflow: hidden; border-block: 1px solid var(--line); padding: var(--s-5) 0; -webkit-mask-image: linear-gradient(90deg, transparent, #000 13%, #000 87%, transparent); mask-image: linear-gradient(90deg, transparent, #000 13%, #000 87%, transparent); }
.marquee__track { display: flex; align-items: center; gap: var(--s-5); width: max-content; animation: marquee 55s linear infinite; }
.marquee:hover .marquee__track { animation-play-state: paused; }
.marquee span { font-size: var(--f-4); font-weight: 500; letter-spacing: -0.04em; line-height: 1; white-space: nowrap; color: #fff; }
.marquee span:nth-of-type(even) { font-family: var(--serif); font-style: italic; font-weight: 400; color: var(--dim); letter-spacing: -0.01em; font-size: calc(var(--f-4) * 1.08); }
.marquee .ast { width: 21px; height: 30px; color: #fff; filter: drop-shadow(0 0 8px rgba(255,255,255,.6)); animation: spin 13s linear infinite; }
@keyframes marquee { to { transform: translateX(calc(-50% - var(--s-5) / 2)); } }
@keyframes spin { to { transform: rotate(360deg); } }

/* ── Services: a card lights up white when you touch it ── */
.services { padding: 0 0 var(--s-8); }
.services .head { padding-top: var(--s-8); }
/* two rows of three, widths in golden proportion: 1.618 | 1 | 1, then 1 | 1 | 1.618 */
.bento { --u: calc((100% - 2 * var(--s-4)) / 3.618); display: flex; flex-wrap: wrap; gap: var(--s-4); }
.card { flex: 0 0 var(--u); }
.card:nth-child(1), .card:nth-child(6) { flex-basis: calc(var(--u) * 1.618); }
.card { position: relative; min-height: 288px; background: var(--card); border: 1px solid var(--line); border-radius: var(--r-3); padding: var(--s-5); display: flex; flex-direction: column; overflow: hidden; isolation: isolate; transition: background var(--t) var(--ease), border-color var(--t) var(--ease), box-shadow var(--t) var(--ease), color var(--t) var(--ease), opacity 1s var(--ease-out), transform 1s var(--ease-out); }
.card::before { content: ""; position: absolute; inset: 0; z-index: -1; background: radial-gradient(377px circle at var(--mx, 50%) var(--my, 0%), rgba(255,255,255,.1), transparent 61.8%); opacity: 0; transition: opacity var(--t) var(--ease); }
.card:hover::before { opacity: 1; }
.card:hover { background: #fff; border-color: #fff; box-shadow: 0 0 55px rgba(255,255,255,.22), 0 0 144px rgba(255,255,255,.08); }
.card__top { display: flex; justify-content: space-between; align-items: center; margin-bottom: auto; padding-bottom: var(--s-5); }
.card__icon { display: grid; place-items: center; width: var(--s-6); height: var(--s-6); border-radius: var(--r-2); background: rgba(255,255,255,.05); border: 1px solid var(--line); color: #fff; transition: transform var(--t-long) var(--ease), background var(--t) var(--ease), color var(--t) var(--ease), border-color var(--t) var(--ease); }
.card:hover .card__icon { transform: rotate(-8deg) scale(1.05); background: #000; color: #fff; border-color: #000; }
.card__icon svg { width: 21px; height: 21px; }
.card__badge { font-family: var(--mono); font-size: var(--f--1); padding: var(--s-1) var(--s-3); border-radius: 999px; border: 1px solid var(--line); color: var(--muted); transition: color var(--t) var(--ease), border-color var(--t) var(--ease); }
.card h3 { font-size: var(--f-3); font-weight: 500; letter-spacing: -0.04em; line-height: 1.1; margin: 0 0 var(--s-3); color: #fff; transition: color var(--t) var(--ease); }
.card h3 em { display: block; font-family: var(--serif); font-weight: 400; font-size: 1em; letter-spacing: -0.01em; color: var(--dim); transition: color var(--t) var(--ease); }
:lang(zh) .card h3 em { font-family: var(--sans); font-size: .62em; margin-top: var(--s-2); }
.card p { color: var(--muted); margin: 0 0 var(--s-4); max-width: 34em; transition: color var(--t) var(--ease); }
.tags { display: flex; flex-wrap: wrap; gap: var(--s-2); }
.tags span { font-family: var(--mono); font-size: var(--f--1); padding: var(--s-1) var(--s-3); border-radius: var(--r-1); background: rgba(255,255,255,.05); color: var(--muted); transition: background var(--t) var(--ease), color var(--t) var(--ease); }
.card:hover h3 { color: #000; }
.card:hover h3 em, .card:hover .card__badge { color: #71717a; }
.card:hover .card__badge { border-color: #e4e4e7; }
.card:hover p { color: #3f3f46; }
.card:hover .tags span { background: #f4f4f5; color: #3f3f46; }

/* ── Manifesto: words light up one after another while you scroll ── */
.manifesto { padding: var(--s-8) 0; }
.manifesto__text { margin: 0; font-family: var(--serif); font-style: italic; font-size: clamp(var(--f-4), 7.2vw, var(--f-7)); line-height: 1.05; letter-spacing: -0.03em; color: #fff; max-width: 15em; }
:lang(zh) .manifesto__text { font-family: var(--sans); font-style: normal; font-weight: 500; letter-spacing: 0; }
.manifesto__text .m { opacity: .12; transition: opacity .6s var(--ease), text-shadow .6s var(--ease); }
.manifesto__text .m.is-lit { opacity: 1; text-shadow: 0 0 34px rgba(255,255,255,.45); }

/* ── Why Asteria ── */
.why { padding: 0 0 var(--s-8); }
.compare { border-radius: var(--r-3); background: var(--card); border: 1px solid var(--line); overflow: hidden; }
.compare__row { display: grid; grid-template-columns: 1.618fr 1fr 1fr; border-top: 1px solid var(--line); transition: background var(--t) var(--ease); }
.compare__row > div { padding: var(--s-4) var(--s-5); display: flex; align-items: center; gap: var(--s-3); transition: color var(--t) var(--ease); }
.compare__row > div:first-child { background: #fff; color: #000; box-shadow: 0 -1px 0 #e4e4e7; }
.compare__row:not(.compare__head):hover > div:not(:first-child) { color: #fff; }
.compare__row:not(.compare__head):hover { background: rgba(255,255,255,.03); }
.compare__head { border-top: 0; }
.compare__head > div { font-family: var(--mono); font-size: var(--f--1); text-transform: uppercase; letter-spacing: 0.08em; color: var(--dim); padding-block: var(--s-4); }
.compare__us { color: #000 !important; font-weight: 600; }
.compare__us .ast { width: 13px; height: 18px; color: #000; }
.yes::before, .no::before { content: ""; flex: 0 0 21px; height: 21px; border-radius: 50%; background-repeat: no-repeat; background-position: center; background-size: 13px; }
.yes::before { background-color: #000; background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath d='M5 12.5l4.5 4.5L19 7'/%3E%3C/svg%3E"); }
.no { color: var(--muted); }
.no::before { background-color: rgba(255,255,255,.06); background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%2371717a' stroke-width='2.6' stroke-linecap='round'%3E%3Cpath d='M7 7l10 10M17 7L7 17'/%3E%3C/svg%3E"); }

/* ── Reviews: two rows drifting in opposite directions ── */
.reviews { padding: 0 0 var(--s-8); overflow: hidden; }
.reviews__rows { display: grid; gap: var(--s-4); -webkit-mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); }
.reviews__row { display: flex; gap: var(--s-4); width: max-content; animation: marquee 89s linear infinite; }
.reviews__row--rev { animation-direction: reverse; }
.reviews__rows:hover .reviews__row { animation-play-state: paused; }
.review { width: 377px; flex: none; padding: var(--s-5); border-radius: var(--r-3); background: var(--card); border: 1px solid var(--line); transition: background var(--t) var(--ease), color var(--t) var(--ease), box-shadow var(--t) var(--ease); }
.review:hover { background: #fff; color: #000; box-shadow: 0 0 55px rgba(255,255,255,.22); }
.review__stars { color: #fbbf24; letter-spacing: 2px; }
.review h3 { margin: var(--s-3) 0 var(--s-2); font-size: var(--f-1); font-weight: 500; letter-spacing: -0.02em; }
.review p { margin: 0 0 var(--s-4); color: var(--muted); font-size: 15px; transition: color var(--t) var(--ease); }
.review:hover p { color: #3f3f46; }
.review footer { font-size: 14px; font-weight: 500; }
.review footer small { display: block; font-family: var(--mono); font-size: 11px; font-weight: 400; color: var(--dim); }

/* ── Work ── */
.work { padding: var(--s-8) 0; background: var(--bg-2); border-top: 1px solid var(--line); }
.filters { display: flex; flex-wrap: wrap; gap: var(--s-2); margin-bottom: var(--s-5); }
.filters button { height: var(--s-5); padding: 0 var(--s-4); border-radius: 999px; background: transparent; border: 1px solid var(--line); color: var(--muted); font-size: 14px; transition: color var(--t) var(--ease), border-color var(--t) var(--ease), background var(--t) var(--ease), box-shadow var(--t) var(--ease); }
.filters button:hover { color: #fff; border-color: var(--line-2); }
.filters button[aria-selected="true"] { background: #fff; color: #000; border-color: #fff; box-shadow: 0 0 21px rgba(255,255,255,.3); }
.filters sup { font-family: var(--mono); font-size: 10px; margin-left: 3px; opacity: .6; }
.gallery { display: grid; grid-template-columns: repeat(3, 1fr); gap: var(--s-4); }
.shot { position: relative; aspect-ratio: 1 / 1.618; border-radius: var(--r-3); overflow: hidden; background: #111; border: 1px solid var(--line); padding: 0; text-align: left; animation: rise .9s var(--ease-out) both; transition: box-shadow var(--t) var(--ease), border-color var(--t) var(--ease); }
.shot:hover { border-color: #fff; box-shadow: 0 0 55px rgba(255,255,255,.2); }
.shot img { width: 100%; height: auto; min-height: 100%; object-fit: cover; object-position: top; transition: transform var(--dur, 6s) cubic-bezier(.45,0,.55,1); }
.shot:hover img, .shot:focus-visible img { transform: translateY(var(--shift, 0)); }
.shot::after { content: ""; position: absolute; inset: auto 0 0; height: 38.2%; background: linear-gradient(transparent, rgba(0,0,0,.7)); pointer-events: none; }
.shot__tag { position: absolute; left: var(--s-3); bottom: var(--s-3); z-index: 1; font-family: var(--mono); font-size: var(--f--1); padding: var(--s-1) var(--s-3); border-radius: 999px; background: #fff; color: #000; }
.shot__hint { position: absolute; right: var(--s-3); bottom: var(--s-3); z-index: 1; width: var(--s-5); height: var(--s-5); display: grid; place-items: center; border-radius: 50%; background: #fff; color: #000; transform: scale(0) rotate(-45deg); transition: transform var(--t) var(--ease-out); }
.shot:hover .shot__hint { transform: none; }
.work__more { display: flex; justify-content: center; margin-top: var(--s-6); }
.work__more[hidden] { display: none; }

.lightbox { position: fixed; inset: 0; z-index: 1000; background: rgba(0,0,0,.94); backdrop-filter: blur(13px); display: grid; place-items: center; color: #fff; animation: fade var(--t) var(--ease); }
@keyframes fade { from { opacity: 0; } }
.lightbox[hidden] { display: none; }
.lightbox__frame { width: min(900px, calc(100vw - 144px)); height: calc(100vh - 89px); overflow-y: auto; border-radius: var(--r-2); background: #111; overscroll-behavior: contain; }
.lightbox__frame img { width: 100%; }
.lightbox__close, .lightbox__nav { position: absolute; background: rgba(255,255,255,.08); border: 1px solid var(--line-2); color: #fff; width: var(--s-6); height: var(--s-6); border-radius: 50%; font-size: var(--f-2); line-height: 1; transition: background var(--t) var(--ease), color var(--t) var(--ease); }
.lightbox__close:hover, .lightbox__nav:hover { background: #fff; color: #000; }
.lightbox__close { top: var(--s-4); right: var(--s-4); }
.lightbox__nav { top: 50%; transform: translateY(-50%); }
.lightbox__prev { left: var(--s-4); }
.lightbox__next { right: var(--s-4); }
.lightbox__count { position: absolute; bottom: var(--s-3); margin: 0; color: var(--muted); }

/* ── Contact ── */
.contact { padding: var(--s-8) 0; background-image: linear-gradient(var(--line) 1px, transparent 1px), linear-gradient(90deg, var(--line) 1px, transparent 1px); background-size: var(--s-7) var(--s-7); }
.contact::before { content: ""; position: absolute; inset: 0; background: radial-gradient(ellipse 61.8% 61.8% at 50% 38.2%, transparent, var(--bg) 80%); pointer-events: none; }
.contact .container { position: relative; }
.contact__grid { display: grid; grid-template-columns: 1fr 1.618fr; gap: var(--s-6); align-items: start; }
.contact__side { display: grid; gap: var(--s-4); }
.direct .head { margin-bottom: var(--s-5); }
.form, .panel { background: rgba(14,14,16,.92); border: 1px solid var(--line); border-radius: var(--r-3); padding: var(--s-5); backdrop-filter: blur(13px); }
.form h3, .panel h3 { margin: 0 0 var(--s-4); font-size: var(--f-1); font-weight: 500; letter-spacing: -0.03em; color: #fff; }
.form label { display: flex; flex-direction: column; gap: var(--s-2); font-size: 14px; color: var(--muted); margin-bottom: var(--s-4); min-width: 0; }
.form small { color: var(--dim); font-size: var(--f--1); }
.form__row { display: grid; grid-template-columns: 1fr 1fr; gap: var(--s-3); }
.form input, .form select, .form textarea { width: 100%; min-width: 0; height: var(--s-6); background-color: rgba(255,255,255,.03); border: 1px solid var(--line); border-radius: var(--r-2); padding: 0 var(--s-3); font-size: var(--f-0); color: #fff; outline: none; transition: border-color var(--t) var(--ease), background var(--t) var(--ease), box-shadow var(--t) var(--ease); }
.form textarea { height: auto; padding: var(--s-3); resize: vertical; line-height: 1.5; }
.form select { appearance: none; background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%23a1a1aa' stroke-width='2'%3E%3Cpath d='m6 9 6 6 6-6'/%3E%3C/svg%3E"); background-repeat: no-repeat; background-position: right var(--s-3) center; background-size: 16px; padding-right: var(--s-5); }
.form select option { background: #111; color: #fff; }
.form input:hover, .form select:hover, .form textarea:hover { border-color: var(--line-2); }
.form input:focus, .form select:focus, .form textarea:focus { border-color: #fff; background-color: rgba(255,255,255,.06); box-shadow: 0 0 0 4px rgba(255,255,255,.06), 0 0 21px rgba(255,255,255,.12); }
.form .invalid { border-color: #ef4444; animation: shake .38s var(--ease); }
@keyframes shake { 25% { transform: translateX(-5px); } 75% { transform: translateX(5px); } }
.phone { display: grid; grid-template-columns: 110px 1fr; gap: var(--s-2); }
.form__status { min-height: 1.6em; margin: var(--s-3) 0 0; font-size: 14px; color: var(--muted); text-align: center; }
.form__status.ok { color: #4ade80; }
.form__status.err { color: #f87171; }

.direct { display: flex; flex-direction: column; gap: var(--s-4); }
.direct__list { display: grid; gap: var(--s-2); }
.direct__list a, .direct__list div { display: flex; align-items: center; gap: var(--s-3); padding: var(--s-3); border-radius: var(--r-2); background: rgba(255,255,255,.03); border: 1px solid transparent; transition: background var(--t) var(--ease), color var(--t) var(--ease), box-shadow var(--t) var(--ease); min-width: 0; }
.direct__list a:hover { background: #fff; color: #000; box-shadow: 0 0 34px rgba(255,255,255,.2); }
.direct__list a:hover b { color: #000; }
.direct__list span:first-child { display: grid; place-items: center; width: 42px; height: 42px; flex: none; border-radius: var(--r-2); background: #fff; color: #000; transition: background var(--t) var(--ease), color var(--t) var(--ease); }
.direct__list a:hover span:first-child { background: #000; color: #fff; }
.direct__list span:last-child { min-width: 0; }
.direct__list svg { width: 18px; height: 18px; }
.direct__list small { display: block; font-family: var(--mono); color: var(--dim); font-size: var(--f--1); text-transform: uppercase; letter-spacing: .06em; }
.direct__list b { display: block; font-weight: 500; color: #fff; overflow-wrap: anywhere; transition: color var(--t) var(--ease); }
.panel--light { background: #fff; border-color: #fff; color: #000; box-shadow: 0 0 55px rgba(255,255,255,.12); }
.panel--light h3 { color: #000; }
.panel__head { display: flex; gap: var(--s-3); align-items: center; margin-bottom: var(--s-4); }
.panel__head h3 { margin: 0; }
.panel__head p { margin: 0; color: #71717a; font-size: 14px; }
.panel__icon { display: grid; place-items: center; width: var(--s-6); height: var(--s-6); border-radius: var(--r-2); background: #000; color: #fff; flex: none; }
.panel__icon svg { width: 21px; height: 21px; }
.checks { display: grid; gap: var(--s-3); }
.checks li { display: flex; gap: var(--s-3); align-items: center; color: #3f3f46; font-size: 15px; }
.checks li::before { content: ""; width: 5px; height: 5px; border-radius: 50%; background: #16a34a; flex: none; }

/* ── Footer ── */
.footer { overflow: hidden; padding-top: var(--s-8); border-top: 1px solid var(--line); background: #000; }
.footer__grid { display: grid; grid-template-columns: 1.618fr 1fr 1fr; gap: var(--s-6); }
.footer h3 { font-family: var(--mono); font-size: var(--f--1); font-weight: 400; text-transform: uppercase; letter-spacing: 0.08em; margin: var(--s-2) 0 var(--s-4); color: var(--dim); }
.footer ul { display: grid; gap: var(--s-3); }
.footer ul a { color: var(--muted); transition: color var(--t) var(--ease), text-shadow var(--t) var(--ease); }
.footer ul a:hover { color: #fff; text-shadow: 0 0 13px rgba(255,255,255,.7); }
.footer__blurb { color: var(--muted); margin: var(--s-4) 0; max-width: 26em; }
.footer__contact li { display: flex; align-items: center; gap: var(--s-3); font-size: 14px; min-width: 0; }
.footer__contact svg { width: 16px; height: 16px; color: var(--muted); flex: none; }
.footer__contact a { color: #fff; overflow-wrap: anywhere; }
/* big wordmark — the logo star is the dot on the i */
.footer__word { margin: var(--s-7) 0 0; padding: 0.16em var(--s-4) 0; font-size: min(25vw, 377px); font-weight: 500; letter-spacing: -0.07em; line-height: .8; text-align: center; white-space: nowrap; color: #fff; user-select: none; -webkit-mask-image: linear-gradient(180deg, #000 50%, transparent 100%); mask-image: linear-gradient(180deg, #000 50%, transparent 100%); }
.footer__word .l { display: inline-block; transform: translateY(61.8%); opacity: 0; transition: transform 1.2s var(--ease-out), opacity 1.2s var(--ease-out); transition-delay: calc(var(--li) * 70ms); }
.footer__word.is-in .l { transform: none; opacity: 1; }
.footer__word .l--i { position: relative; }
.footer__word .l:last-child { margin-left: 0.05em; }
.footer__word .star { position: absolute; left: calc(50% + 0.035em); top: -0.02em; width: 0.13em; height: 0.184em; margin-left: -0.065em; overflow: visible; color: #fff; filter: drop-shadow(0 0 0.03em rgba(255,255,255,.8)); opacity: 0; transform: scale(0) rotate(-300deg); }
.footer__word.is-in .star { animation: star-in 1.618s var(--ease-out) 1s forwards; }
@keyframes star-in { 0% { opacity: 0; transform: scale(0) rotate(-300deg); } 61.8% { opacity: 1; transform: scale(1.18) rotate(12deg); } 100% { opacity: 1; transform: none; } }
.footer__bottom { position: relative; display: flex; justify-content: space-between; flex-wrap: wrap; gap: var(--s-3); padding-top: var(--s-4); padding-bottom: var(--s-4); border-top: 1px solid var(--line); color: var(--dim); font-size: 13px; }
.footer__bottom a { color: var(--muted); text-decoration: underline; text-underline-offset: 3px; }
.footer__bottom a:hover { color: #fff; }

/* ── Floating WhatsApp ── */
.wa { position: fixed; right: var(--s-5); bottom: var(--s-5); z-index: 900; width: var(--s-6); height: var(--s-6); display: grid; place-items: center; border-radius: 50%; color: #000; background: #fff; box-shadow: 0 0 34px rgba(255,255,255,.3); transition: transform var(--t) var(--ease); }
.wa:hover { transform: scale(1.08); }
.wa svg { width: 26px; height: 26px; fill: currentColor; stroke: none; }
.wa[hidden] { display: none; }

@media (prefers-reduced-motion: reduce) {
  *, *::before, *::after { animation: none !important; transition: none !important; }
  .reveal, [data-split] .w > span, .footer__word .l { opacity: 1; transform: none; }
  .hero__ast path { stroke-dashoffset: 0; }
  .footer__word .star { opacity: 1; transform: none; }
  .manifesto__text .m { opacity: 1; }
  html { scroll-behavior: auto; }
}

/* ── Tablet ── */
@media (max-width: 1020px) {
  .nav, .header__cta { display: none; }
  .burger { display: block; }
  .mobile-nav { display: grid; max-height: 0; overflow: hidden; padding: 0 var(--s-5); background: rgba(5,5,5,.97); backdrop-filter: blur(21px); transition: max-height var(--t) var(--ease), padding var(--t) var(--ease); }
  .mobile-nav a { padding: var(--s-3) 0; font-size: var(--f-2); font-weight: 500; letter-spacing: -0.03em; border-bottom: 1px solid var(--line); color: #fff; }
  .mobile-nav .btn { margin-top: var(--s-4); border: 0; color: #000; font-size: var(--f-0); }
  .header.is-open .mobile-nav { max-height: 460px; padding: var(--s-2) var(--s-5) var(--s-5); }
  .header.is-open { background: rgba(5,5,5,.97); }
  .hero__grid { grid-template-columns: 1fr; }
  .hero__star { width: 233px; justify-self: start; }
  .head--split { grid-template-columns: 1fr; gap: var(--s-4); }
  .bento { --u: calc((100% - var(--s-4)) / 2); }
  .card:nth-child(n) { flex-basis: var(--u); }
  .gallery { grid-template-columns: 1fr 1fr; }
  .contact__grid { grid-template-columns: 1fr; }
  .footer__grid { grid-template-columns: 1fr 1fr; }
  .footer__grid > div:first-child { grid-column: 1 / -1; }
}

/* ── Phones: compact, less scrolling, carousels instead of long columns ── */
@media (max-width: 640px) {
  .container, .header__inner { padding: 0 var(--s-4); }
  .header__inner { height: 70px; }
  .lang__btn { height: 38px; }
  .hero { min-height: 0; padding: calc(70px + var(--s-6)) 0 var(--s-6); }
  .hero__star { display: none; }
  .badge { margin-bottom: var(--s-4); height: 38px; font-size: 13px; }
  .hero__title { margin-bottom: var(--s-4); }
  .hero__lead { font-size: var(--f-0); margin-bottom: var(--s-5); }
  .hero__actions .btn { height: 47px; padding: 0 var(--s-4); }

  .services, .why, .work, .contact, .reviews { padding-bottom: var(--s-6); }
  .services .head, .work, .contact { padding-top: var(--s-6); }
  .manifesto { padding: var(--s-7) 0; }
  .head, .head--split { margin-bottom: var(--s-5); }
  .title { font-size: var(--f-4); margin-bottom: var(--s-3); }
  .lead { font-size: var(--f-0); }
  .marquee { padding: var(--s-4) 0; }
  .marquee span { font-size: var(--f-2); }

  .bento, .gallery { display: flex; gap: var(--s-3); overflow-x: auto; scroll-snap-type: x mandatory; margin: 0 calc(-1 * var(--s-4)); padding: 0 var(--s-4) var(--s-3); scrollbar-width: none; }
  .bento::-webkit-scrollbar, .gallery::-webkit-scrollbar { display: none; }
  .card { flex: 0 0 84%; min-height: 0; scroll-snap-align: center; padding: var(--s-4); }
  .card:nth-child(n) { flex-basis: 84%; }
  .card__top { padding-bottom: var(--s-4); }
  .card h3 { font-size: var(--f-2); }
  .card p { font-size: 15px; }
  .shot { flex: 0 0 61.8%; scroll-snap-align: center; }
  .work__more { display: none; }
  .filters { flex-wrap: nowrap; overflow-x: auto; margin: 0 calc(-1 * var(--s-4)) var(--s-4); padding: 0 var(--s-4); scrollbar-width: none; }
  .filters button { flex: none; }
  .review { width: 300px; padding: var(--s-4); }

  .compare__head { display: none !important; }
  .compare__row { display: flex; flex-wrap: wrap; }
  .compare__row:nth-child(2) { border-top: 0; }
  .compare__row > div:first-child { flex: 1 0 100%; padding: var(--s-3) var(--s-4); }
  .compare__row > div:nth-child(2), .compare__row > div:nth-child(3) { flex: 1 1 50%; padding: var(--s-2) var(--s-4) var(--s-3); font-size: 13px; }
  .compare__row > div.no::before { flex-basis: 16px; height: 16px; background-size: 10px; }

  .form, .panel { padding: var(--s-4); }
  .form h3, .panel h3 { margin-bottom: var(--s-3); }
  .form label { margin-bottom: var(--s-3); font-size: 13px; }
  .form input, .form select { height: 47px; }
  .form__row { grid-template-columns: 1fr 1fr; gap: var(--s-2); }
  .form__row:nth-of-type(2) { grid-template-columns: 1fr; gap: 0; }
  .form textarea { min-height: 89px; }

  .footer { padding-top: var(--s-6); }
  .footer__grid { gap: var(--s-4); }
  .footer ul { gap: var(--s-2); }
  .footer__word { margin-top: var(--s-6); }
  .lightbox__frame { width: calc(100vw - 26px); height: calc(100vh - 144px); }
  .lightbox__nav { top: auto; bottom: var(--s-4); transform: none; }
  .lightbox__count { bottom: var(--s-5); }
  .wa { right: var(--s-4); bottom: var(--s-4); }
}

/* ════════ Light sections: white, in golden proportion with the night ones ════════ */
.light { --line: rgba(0,0,0,.08); --line-2: rgba(0,0,0,.16); --muted: #52525b; --dim: #a1a1aa; background: #fff; color: #0a0a0a; overflow: hidden; }
.light::before { display: none; }
.light .title { color: #0a0a0a; }
.light .title em { color: #a1a1aa; }
.light .lead { color: #52525b; }
.light .btn--glow { background: transparent; color: #0a0a0a; box-shadow: inset 0 0 0 1px rgba(0,0,0,.14); }
.light .btn--glow:hover { background: #0a0a0a; color: #fff; box-shadow: 0 13px 34px -13px rgba(0,0,0,.5); }
.light .btn--solid { background: #0a0a0a; color: #fff; box-shadow: 0 13px 34px -13px rgba(0,0,0,.45); }
.light .btn--solid:hover { box-shadow: 0 21px 55px -21px rgba(0,0,0,.6); }
.light .container { position: relative; z-index: 1; }

/* discreet golden rectangle + spiral drawn behind the white sections */
.phi-bg { position: absolute; inset: 0; width: 100%; height: 100%; color: #0a0a0a; opacity: .07; pointer-events: none; }
.phi-bg--flip { transform: scaleX(-1); }
.phi-bg rect, .phi-bg path { fill: none; stroke: currentColor; stroke-width: 1; vector-effect: non-scaling-stroke; stroke-dasharray: 1; stroke-dashoffset: 1; transition: stroke-dashoffset 3.4s var(--ease); }
.phi-bg path { transition-duration: 4.2s; transition-delay: .6s; }
.phi-bg.is-in rect, .phi-bg.is-in path { stroke-dashoffset: 0; }

/* white cards; touching one turns it to night */
.light .card { background: #fff; border-color: rgba(0,0,0,.08); box-shadow: 0 1px 0 rgba(0,0,0,.02), 0 21px 55px -34px rgba(0,0,0,.18); }
.light .card::before { background: radial-gradient(377px circle at var(--mx, 50%) var(--my, 0%), rgba(255,255,255,.12), transparent 61.8%); }
.light .card h3 { color: #0a0a0a; }
.light .card h3 em, .light .card__badge { color: #a1a1aa; }
.light .card__badge { border-color: rgba(0,0,0,.1); }
.light .card p { color: #52525b; }
.light .card__icon { background: #f4f4f5; border-color: rgba(0,0,0,.06); color: #0a0a0a; }
.light .tags span { background: #f4f4f5; color: #52525b; }
.light .card:hover { background: #0a0a0a; border-color: #0a0a0a; box-shadow: 0 34px 89px -34px rgba(0,0,0,.55); }
.light .card:hover h3 { color: #fff; }
.light .card:hover h3 em, .light .card:hover .card__badge { color: #71717a; }
.light .card:hover .card__badge { border-color: rgba(255,255,255,.14); }
.light .card:hover p { color: #a1a1aa; }
.light .card:hover .card__icon { background: #fff; color: #0a0a0a; border-color: #fff; }
.light .card:hover .tags span { background: rgba(255,255,255,.08); color: #a1a1aa; }

/* comparison on white: Asteria in night, the others in daylight */
.light .compare { background: #fff; border-color: rgba(0,0,0,.08); box-shadow: 0 34px 89px -55px rgba(0,0,0,.3); }
.light .compare__row { border-top-color: rgba(0,0,0,.07); }
.light .compare__row > div:first-child { background: #0a0a0a; color: #fff; box-shadow: 0 -1px 0 rgba(255,255,255,.07); }
.light .compare__us { color: #fff !important; }
.light .compare__us .ast { color: #fff; }
.light .yes::before { background-color: #fff; background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%23000' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath d='M5 12.5l4.5 4.5L19 7'/%3E%3C/svg%3E"); }
.light .no { color: #52525b; }
.light .no::before { background-color: #f4f4f5; }
.light .compare__head > div { color: #a1a1aa; }
.light .compare__row:not(.compare__head):hover { background: #fafafa; }
.light .compare__row:not(.compare__head):hover > div:not(:first-child) { color: #0a0a0a; }

/* contact on white */
.light.contact { background-image: none; }
.light .form { background: #fff; border-color: rgba(0,0,0,.08); box-shadow: 0 34px 89px -55px rgba(0,0,0,.3); backdrop-filter: none; }
.light .form h3 { color: #0a0a0a; }
.light .form label { color: #52525b; }
.light .form input, .light .form select, .light .form textarea { background-color: #fafafa; border-color: rgba(0,0,0,.08); color: #0a0a0a; }
.light .form select { background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%2371717a' stroke-width='2'%3E%3Cpath d='m6 9 6 6 6-6'/%3E%3C/svg%3E"); }
.light .form select option { background: #fff; color: #0a0a0a; }
.light .form input:hover, .light .form select:hover, .light .form textarea:hover { border-color: rgba(0,0,0,.18); }
.light .form input:focus, .light .form select:focus, .light .form textarea:focus { border-color: #0a0a0a; background-color: #fff; box-shadow: 0 0 0 4px rgba(0,0,0,.05); }
.light .form__status { color: #52525b; }
.light .form__status.ok { color: #16a34a; }
.light .form__status.err { color: #dc2626; }
.light .panel { background: #fafafa; border-color: rgba(0,0,0,.06); backdrop-filter: none; }
.light .panel h3 { color: #0a0a0a; }
.light .direct__list a, .light .direct__list div { background: #fff; }
.light .direct__list span:first-child { background: #0a0a0a; color: #fff; }
.light .direct__list b { color: #0a0a0a; }
.light .direct__list a:hover { background: #0a0a0a; color: #fff; box-shadow: none; }
.light .direct__list a:hover b { color: #fff; }
.light .direct__list a:hover span:first-child { background: #fff; color: #0a0a0a; }
.light .panel--light { background: #0a0a0a; border-color: #0a0a0a; box-shadow: none; }
.light .panel--light h3 { color: #fff; }
.light .panel--light .panel__head p { color: #a1a1aa; }
.light .panel--light .panel__icon { background: #fff; color: #0a0a0a; }
.light .panel--light .checks li { color: #d4d4d8; }
.light .panel--light .checks li::before { background: #22c55e; box-shadow: 0 0 8px #22c55e; }

/* ════════ Desktop: one section per screen, each settles into place ════════ */
@media (min-width: 1021px) and (min-height: 700px) {
  html { scroll-snap-type: y proximity; }
  .hero, .services, .manifesto, .why, .work, .contact, .footer { scroll-snap-align: start; }
  .services, .manifesto, .why, .work, .contact { min-height: 100vh; min-height: 100svh; display: flex; flex-direction: column; justify-content: center; padding: calc(var(--s-7) + var(--s-3)) 0 var(--s-6); }
  .services .head { padding-top: 0; }
  .services .head, .why .head, .work .head { margin-bottom: var(--s-5); }
  .services .head { display: grid; grid-template-columns: 1.618fr 1fr; gap: var(--s-6); align-items: end; max-width: none; }
  .services .head .title { margin: 0; }
  .manifesto { justify-content: center; }
  .gallery { grid-template-columns: repeat(4, 1fr); }
  /* compact cards: the description takes the icon's place when the card lights up */
  .services .head { grid-template-columns: 2.618fr 1fr; }
  .services .title { font-size: var(--f-5); }
  .card { height: 250px; min-height: 0; padding: var(--s-4) var(--s-4) var(--s-4) var(--s-5); justify-content: flex-end; }
  .card__top { position: absolute; top: var(--s-4); left: var(--s-5); right: var(--s-4); padding: 0; transition: opacity var(--t) var(--ease); }
  .card h3 { font-size: var(--f-2); margin-bottom: var(--s-3); }
  .card:nth-child(n+2):nth-child(-n+5) h3 { font-size: var(--f-1); hyphens: auto; -webkit-hyphens: auto; }
  .contact .form input, .contact .form select { height: 47px; }
  .contact .form textarea { height: 89px; min-height: 89px; }
  .contact .form label { margin-bottom: var(--s-3); }
  .card p { position: absolute; top: var(--s-4); left: var(--s-5); right: var(--s-4); margin: 0; font-size: 14px; line-height: 1.5; opacity: 0; transform: translateY(8px); transition: opacity var(--t) var(--ease), transform var(--t) var(--ease), color var(--t) var(--ease); }
  .card:hover .card__top { opacity: 0; }
  .card:hover p { opacity: 1; transform: none; }
  .card .tags { flex-wrap: nowrap; overflow: hidden; -webkit-mask-image: linear-gradient(90deg, #000 80%, transparent); mask-image: linear-gradient(90deg, #000 80%, transparent); transition: opacity var(--t) var(--ease); }
  .card .tags span { flex: none; }
  .contact .title { font-size: var(--f-5); }
  .contact .direct > .panel:not(.panel--light) h3 { display: none; }
  .contact .panel { padding: var(--s-4); }
  .contact .panel__head { margin-bottom: var(--s-3); }
  .contact .checks { gap: var(--s-2); }
  .contact__side { display: grid; gap: var(--s-4); }
  .shot { aspect-ratio: 1 / 1.382; }
  .filters { margin-bottom: var(--s-4); }
  .work__more { margin-top: var(--s-5); }
}

/* ── Legal page ── */
.legal { padding: calc(var(--s-7) + var(--s-7)) 0 var(--s-8); }
.legal .container { max-width: 760px; }
.legal h1 { font-weight: 500; font-size: clamp(var(--f-4), 6vw, var(--f-6)); line-height: 1; letter-spacing: -0.045em; margin: 0 0 var(--s-3); color: #fff; }
.legal h1 span { font-family: var(--serif); font-weight: 400; font-style: italic; color: var(--muted); letter-spacing: -0.02em; }
.legal .updated { color: var(--dim); margin: 0 0 var(--s-6); }
.legal h2 { font-size: var(--f-1); font-weight: 500; letter-spacing: -0.03em; margin: var(--s-6) 0 var(--s-3); padding-top: var(--s-5); border-top: 1px solid var(--line); color: #fff; }
.legal p { color: var(--muted); }
.legal p strong { color: #fff; font-weight: 500; }
.legal a { color: #fff; text-decoration: underline; text-underline-offset: 3px; }
.facts { margin: 0; display: grid; grid-template-columns: 1fr 1.618fr; border: 1px solid var(--line); border-radius: var(--r-3); overflow: hidden; }
.facts dt, .facts dd { margin: 0; padding: var(--s-3) var(--s-4); border-top: 1px solid var(--line); font-size: 15px; }
.facts dt { background: #fff; color: #52525b; border-top-color: #e4e4e7; font-family: var(--mono); font-size: var(--f--1); text-transform: uppercase; letter-spacing: .06em; display: flex; align-items: center; }
.facts dd { color: #fff; background: var(--card); }
.facts dt:first-of-type, .facts dd:first-of-type { border-top: 0; }
@media (max-width: 640px) {
  .facts { grid-template-columns: 1fr; }
  .facts dd { border-top: 0; padding-top: 0; }
  .facts dt { background: var(--card); color: var(--dim); padding-bottom: var(--s-1); }
  .facts dt:not(:first-of-type) { border-top: 1px solid var(--line); }
}

/* ════════ Round 7: white header & hero, compact manifesto and footer, phones side by side ════════ */

/* header: white, black type */
.header, .header.is-scrolled { background: rgba(255,255,255,.92); backdrop-filter: blur(21px) saturate(1.6); -webkit-backdrop-filter: blur(21px) saturate(1.6); border-bottom: 1px solid rgba(0,0,0,.06); }
.header .logo { color: #0a0a0a; }
.header .logo:hover .ast { filter: none; }
.header .nav a { color: #52525b; text-shadow: none; }
.header .nav a:hover { color: #0a0a0a; text-shadow: none; }
.header .lang__btn { color: #52525b; border-color: rgba(0,0,0,.1); }
.header .lang__btn:hover, .header .lang__btn[aria-expanded="true"] { color: #0a0a0a; border-color: rgba(0,0,0,.2); }
.header .lang__menu { background: rgba(255,255,255,.98); border-color: rgba(0,0,0,.08); box-shadow: 0 34px 55px -21px rgba(0,0,0,.25); }
.header .lang__menu button { color: #52525b; }
.header .lang__menu button:hover, .header .lang__menu button[aria-selected="true"] { background: #0a0a0a; color: #fff; }
.header .btn--glow, .header .btn--solid { background: #0a0a0a; color: #fff; box-shadow: 0 13px 34px -13px rgba(0,0,0,.45); }
.header .btn--glow:hover { background: #27272a; box-shadow: 0 13px 34px -13px rgba(0,0,0,.6); }
.header .burger span { background: #0a0a0a; }
.header .mobile-nav, .header.is-open { background: rgba(255,255,255,.98); }
.header .mobile-nav a { color: #0a0a0a; border-bottom-color: rgba(0,0,0,.08); }
.header .mobile-nav .btn { color: #fff; }

/* hero in daylight: the star is drawn in ink, with a soft shadow for light */
.hero.light { overflow: hidden; }
.hero.light .hero__title { color: #0a0a0a; }
.light .rotator em { color: #0a0a0a !important; }
.hero.light .hero__lead { color: #52525b; }
.hero.light .ticker { color: #71717a; }
.hero.light .ticker__dot { background: #0a0a0a; box-shadow: none; }
.hero.light .hero__ast { color: #0a0a0a; filter: drop-shadow(0 21px 34px rgba(0,0,0,.18)); }
.hero.light .hero__halo { background: radial-gradient(circle, rgba(0,0,0,.05), rgba(0,0,0,.015) 38.2%, transparent 61.8%); }
.hero .marquee { background: #0a0a0a; border: 0; margin-top: var(--s-6); -webkit-mask-image: none; mask-image: none; }
.hero .marquee__track { -webkit-mask-image: none; }
.hero .marquee span { color: #fff; }

/* manifesto: one line, a thin band of night */
.manifesto { min-height: 0 !important; padding: var(--s-6) 0 !important; display: block !important; }
.manifesto__text { font-size: clamp(var(--f-1), 3.1vw, var(--f-4)); max-width: none; text-align: center; line-height: 1.2; }
@media (min-width: 1021px) { .manifesto__text { white-space: nowrap; } }

/* footer: smaller, calmer */
.footer { padding-top: var(--s-7); }
.footer__word { font-size: min(14.6vw, 210px); margin-top: var(--s-6); }

@media (min-width: 1021px) and (min-height: 700px) {
  .manifesto { scroll-snap-align: none; }
}

/* ── phones: everything readable side by side, nothing to swipe ── */
@media (max-width: 640px) {
  .hero.light { padding-top: calc(70px + var(--s-5)); }
  .hero__grid { padding-top: 0; }
  .hero__star { display: block; order: -1; justify-self: start; width: 44px; margin-bottom: var(--s-4); }
  .hero__halo { display: none; }
  .hero.light .hero__ast { transform: none; animation: spin 21s linear infinite; filter: none; }
  .hero .marquee { margin-top: var(--s-5); padding: var(--s-3) 0; }
  .marquee__track { animation-duration: 21s; gap: var(--s-4); }
  .marquee span, .marquee span:nth-of-type(even) { font-size: var(--f-0); }
  .marquee .ast { width: 11px; height: 16px; }

  /* services: 2 × 3 grid, compact cards */
  .bento { display: grid; grid-template-columns: 1fr 1fr; gap: var(--s-2); overflow: visible; margin: 0; padding: 0; }
  .card, .card:nth-child(n) { flex: none; min-height: 0; padding: var(--s-3); border-radius: var(--r-2); }
  .card__top { padding-bottom: var(--s-3); }
  .card__icon { width: 34px; height: 34px; border-radius: var(--r-1); }
  .card__icon svg { width: 16px; height: 16px; }
  .card__badge, .card .tags { display: none; }
  .card h3 { font-size: 16px; line-height: 1.2; margin-bottom: var(--s-2); }
  .card h3 em { font-size: 15px; }
  .card p { font-size: 12.6px; line-height: 1.45; margin: 0; display: -webkit-box; -webkit-line-clamp: 4; -webkit-box-orient: vertical; overflow: hidden; }

  /* comparison: three columns side by side */
  .compare__head { display: grid !important; }
  .compare__row, .compare__row:nth-child(n) { display: grid; grid-template-columns: 1.236fr 1fr 1fr; border-top: 1px solid rgba(0,0,0,.07); }
  .compare__row > div, .compare__row > div:first-child, .compare__row > div:nth-child(2), .compare__row > div:nth-child(3) { flex: none; padding: var(--s-2) var(--s-2); font-size: 12px; line-height: 1.35; gap: 6px; }
  .compare__head > div { font-size: 9.5px; letter-spacing: .04em; padding-block: var(--s-3); }
  .compare__row > div::after { content: none !important; }
  .yes::before, .no::before { flex-basis: 14px; height: 14px; background-size: 9px; }
  .compare__row > div.no::before { display: none; }
  .compare__us .ast { width: 9px; height: 13px; }

  /* work: 2 × 2 grid, filters wrap */
  .filters { flex-wrap: wrap; overflow: visible; margin: 0 0 var(--s-4); padding: 0; gap: 6px; }
  .filters button { height: 30px; padding: 0 var(--s-3); font-size: 12.6px; }
  .gallery { display: grid; grid-template-columns: 1fr 1fr; gap: var(--s-2); overflow: visible; margin: 0; padding: 0; }
  .shot { flex: none; aspect-ratio: 1 / 1.382; border-radius: var(--r-2); }
  .shot__tag { font-size: 10px; left: var(--s-2); bottom: var(--s-2); }
  .work__more { display: flex; margin-top: var(--s-4); }

  /* manifesto + footer */
  .manifesto { padding: var(--s-5) 0 !important; }
  .manifesto__text { font-size: var(--f-1); text-align: left; }
  .footer { padding-top: var(--s-6); }
  .footer__grid { grid-template-columns: 1fr 1fr; gap: var(--s-4) var(--s-3); }
  .footer__blurb { font-size: 14px; }
  .footer ul { gap: 6px; }
  .footer ul a { font-size: 14px; }
  .footer__word { font-size: 23.6vw; margin-top: var(--s-5); padding-top: 0.2em; }
  .footer__bottom { font-size: 11px; }
}
.badge[hidden] { display: none; }
.hero__title { font-size: clamp(var(--f-4), 4vw, 58px); }
@media (max-width: 640px) {
  .hero__grid { row-gap: 0; }
  .hero__title { font-size: clamp(34px, 9.4vw, var(--f-4)); }
}

/* ════════ Round 8 ════════ */

/* manifesto typed out, white light, blinking caret */
.manifesto { position: relative; overflow: hidden; }
.manifesto__text { color: #fff; text-shadow: 0 0 21px rgba(255,255,255,.35); }
.manifesto__text .mw { white-space: nowrap; }
.manifesto__text .c { opacity: 0; }
.manifesto__text .c.on { opacity: 1; }
.manifesto__text .c.cur { position: relative; }
.manifesto__text .c.cur::after { content: ""; position: absolute; left: 100%; top: .12em; bottom: .08em; width: 2px; margin-left: 3px; background: #fff; box-shadow: 0 0 8px #fff, 0 0 21px rgba(255,255,255,.6); animation: caret 1.05s steps(1) infinite; }
@keyframes caret { 50% { opacity: 0; } }

/* night sections carry fine white lines, fading out at the edges */
.work, .manifesto, .footer { isolation: isolate; }
.work::before, .manifesto::before, .footer::before { content: ""; position: absolute; inset: 0; z-index: -1; pointer-events: none;
  background-image: linear-gradient(rgba(255,255,255,.07) 1px, transparent 1px), linear-gradient(90deg, rgba(255,255,255,.07) 1px, transparent 1px);
  background-size: var(--s-7) var(--s-7); background-position: center top;
  -webkit-mask-image: radial-gradient(ellipse 61.8% 61.8% at 50% 38.2%, #000 20%, transparent 80%); mask-image: radial-gradient(ellipse 61.8% 61.8% at 50% 38.2%, #000 20%, transparent 80%); }
.manifesto::before { -webkit-mask-image: radial-gradient(ellipse 50% 100% at 50% 50%, #000 10%, transparent 85%); mask-image: radial-gradient(ellipse 50% 100% at 50% 50%, #000 10%, transparent 85%); }
.work .container, .footer .container, .footer__word { position: relative; z-index: 1; }

/* why: a larger, calmer comparison */
.why .compare { border-radius: var(--r-3); }
.why .compare__row > div { padding: 17px var(--s-5); font-size: 17px; }
.why .compare__head > div { padding-block: var(--s-4); font-size: var(--f--1); }
.why .compare__row > div:first-child { font-weight: 500; }
.why .compare__row:not(.compare__head) { transition: background var(--t) var(--ease); }
.why .compare__row:not(.compare__head):hover > div:first-child { background: #27272a; }
@media (min-width: 1021px) and (min-height: 700px) {
  .why .head { margin-bottom: var(--s-5); }
  .why .compare__row > div { padding-block: 15px; }
}

@media (max-width: 640px) {
  /* header gets quieter once you scroll */
  .header__inner { transition: height var(--t) var(--ease); }
  .header.is-scrolled { background: rgba(255,255,255,.72); border-bottom-color: rgba(0,0,0,.04); }
  .header.is-scrolled .header__inner { height: 56px; }
  .header.is-scrolled .logo__word { font-size: var(--f-1); }
  .header.is-scrolled .logo .ast { width: 17px; height: 24px; }
  .header.is-scrolled .lang__btn { height: 32px; }

  /* star beside the headline */
  .hero__grid { position: relative; }
  .hero__star { position: absolute; top: 4px; right: var(--s-4); width: 44px; margin: 0; order: 0; }
  .hero__title { padding-right: 58px; }

  /* manifesto: bigger, typed */
  .manifesto { padding: var(--s-6) 0 !important; }
  .manifesto__text { font-size: var(--f-3); line-height: 1.15; }

  /* why: three columns, a bit more room */
  .why .compare__row > div, .why .compare__row > div:first-child, .why .compare__row > div:nth-child(2), .why .compare__row > div:nth-child(3) { padding: 11px var(--s-2); font-size: 12.6px; }
  .why .head .btn { height: 44px; }

  /* work filters: one line, slide sideways for the rest */
  .filters { flex-wrap: nowrap; overflow-x: auto; margin: 0 calc(-1 * var(--s-4)) var(--s-4); padding: 0 var(--s-4); scrollbar-width: none; -webkit-mask-image: linear-gradient(90deg, #000 85%, transparent); mask-image: linear-gradient(90deg, #000 85%, transparent); }
  .filters::-webkit-scrollbar { display: none; }
  .filters button { flex: none; }
}